C21H18N2O3 — CID 766973
N-(3-nitrophenyl)-2,2-diphenylpropanamide (PubChem CID 766973) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(3-nitrophenyl)-2,2-diphenylpropanamide.
| Compound Name | N-(3-nitrophenyl)-2,2-diphenylpropanamide |
|---|---|
| PubChem CID | 766973 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-(3-nitrophenyl)-2,2-diphenylpropanamide |
| SMILES | CC(C(=O)Nc1cccc([N+](=O)[O-])c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c1-21(16-9-4-2-5-10-16,17-11-6-3-7-12-17)20(24)22-18-13-8-14-19(15-18)23(25)26/h2-15H,1H3,(H,22,24) |
| InChIKey | MSEBXDHEKMVPQQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|