(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid

C10H6Cl2O3 — CID 6172511

IUPAC(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C/C(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C10H6Cl2O3/c11-7-2-1-6(5-8(7)12)9(13)3-4-10(14)15/h1-5H,(H,14,15)/b4-3+
InChIKeyXIZWELOARFUPLO-ONEGZZNKSA-N
MW245.06 g/mol
LogP2.82
Rot. Bonds3

About (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid

(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid (PubChem CID 6172511) has the molecular formula C10H6Cl2O3 and a molecular weight of 245.06 g/mol. Its IUPAC name is (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid
PubChem CID6172511
Molecular FormulaC10H6Cl2O3
Molecular Weight245.06 g/mol
Exact Mass243.97
IUPAC Name(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid
SMILESO=C(O)/C=C/C(=O)c1ccc(Cl)c(Cl)c1
InChIInChI=1S/C10H6Cl2O3/c11-7-2-1-6(5-8(7)12)9(13)3-4-10(14)15/h1-5H,(H,14,15)/b4-3+
InChIKeyXIZWELOARFUPLO-ONEGZZNKSA-N
XLogP2.82
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.06
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid (CID 6172511) is (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid is O=C(O)/C=C/C(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
The InChIKey is XIZWELOARFUPLO-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H6Cl2O3/c11-7-2-1-6(5-8(7)12)9(13)3-4-10(14)15/h1-5H,(H,14,15)/b4-3+.
What are the key properties of (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid?
(E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid has a molecular weight of 245.06 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 6172511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).