C12H8Cl2O4 — CID 89389823
(2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioic acid (PubChem CID 89389823) has the molecular formula C12H8Cl2O4 and a molecular weight of 287.10 g/mol. Its IUPAC name is (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioic acid.
| Compound Name | (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioic acid |
|---|---|
| PubChem CID | 89389823 |
| Molecular Formula | C12H8Cl2O4 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | (2E,4Z)-2-(3,4-dichlorophenyl)hexa-2,4-dienedioic acid |
| SMILES | O=C(O)/C=C\C=C(\C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2O4/c13-9-5-4-7(6-10(9)14)8(12(17)18)2-1-3-11(15)16/h1-6H,(H,15,16)(H,17,18)/b3-1-,8-2+ |
| InChIKey | RBXOLGVIGQMNOF-UEAKZQPUSA-N |
| XLogP | 3.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|