C21H10Cl6O — CID 102081639
(E)-1,2,3-tris(3,4-dichlorophenyl)prop-2-en-1-one (PubChem CID 102081639) has the molecular formula C21H10Cl6O and a molecular weight of 491.03 g/mol. Its IUPAC name is (E)-1,2,3-tris(3,4-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1,2,3-tris(3,4-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102081639 |
| Molecular Formula | C21H10Cl6O |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 487.89 |
| IUPAC Name | (E)-1,2,3-tris(3,4-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H10Cl6O/c22-15-4-1-11(8-18(15)25)7-14(12-2-5-16(23)19(26)9-12)21(28)13-3-6-17(24)20(27)10-13/h1-10H/b14-7+ |
| InChIKey | LRVYZLNTXGJFJS-VGOFMYFVSA-N |
| XLogP | 9.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|