C9H7Cl2NO2 — CID 130167282
2-amino-3-(3,4-dichlorophenyl)prop-2-enoic acid (PubChem CID 130167282) has the molecular formula C9H7Cl2NO2 and a molecular weight of 232.07 g/mol. Its IUPAC name is 2-amino-3-(3,4-dichlorophenyl)prop-2-enoic acid.
| Compound Name | 2-amino-3-(3,4-dichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 130167282 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-amino-3-(3,4-dichlorophenyl)prop-2-enoic acid |
| SMILES | NC(=Cc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H7Cl2NO2/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-4H,12H2,(H,13,14) |
| InChIKey | VMLGMRIWADCTBJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|