C9H10Cl2N2O — CID 117058994
(E)-2-(3,4-dichlorophenyl)-1-N'-methoxyethene-1,1-diamine (PubChem CID 117058994) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is (E)-2-(3,4-dichlorophenyl)-1-N'-methoxyethene-1,1-diamine.
| Compound Name | (E)-2-(3,4-dichlorophenyl)-1-N'-methoxyethene-1,1-diamine |
|---|---|
| PubChem CID | 117058994 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | (E)-2-(3,4-dichlorophenyl)-1-N'-methoxyethene-1,1-diamine |
| SMILES | CON/C(N)=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O/c1-14-13-9(12)5-6-2-3-7(10)8(11)4-6/h2-5,13H,12H2,1H3/b9-5+ |
| InChIKey | VNJGCXZMFGQXJJ-WEVVVXLNSA-N |
| XLogP | 2.40 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|