C8H7Cl2NO — CID 53468142
(E)-1-(3,4-dichlorophenyl)-N-methoxymethanimine (PubChem CID 53468142) has the molecular formula C8H7Cl2NO and a molecular weight of 204.06 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-N-methoxymethanimine.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 53468142 |
| Molecular Formula | C8H7Cl2NO |
| Molecular Weight | 204.06 g/mol |
| Exact Mass | 202.99 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-N-methoxymethanimine |
| SMILES | CO/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H7Cl2NO/c1-12-11-5-6-2-3-7(9)8(10)4-6/h2-5H,1H3/b11-5+ |
| InChIKey | PITZMRODOAODRV-VZUCSPMQSA-N |
| XLogP | 2.97 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.06 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|