C11H13Cl2NOS — CID 67122775
(R)-N-[(3,4-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 67122775) has the molecular formula C11H13Cl2NOS and a molecular weight of 278.20 g/mol. Its IUPAC name is (R)-N-[(3,4-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3,4-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67122775 |
| Molecular Formula | C11H13Cl2NOS |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | (R)-N-[(3,4-dichlorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2NOS/c1-11(2,3)16(15)14-7-8-4-5-9(12)10(13)6-8/h4-7H,1-3H3/t16-/m1/s1 |
| InChIKey | KFXZHKFTZWUGGT-MRXNPFEDSA-N |
| XLogP | 3.87 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|