C12H16BrNOS — CID 171666329
(NE,S)-N-[(4-bromo-3-methylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 171666329) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is (NE,S)-N-[(4-bromo-3-methylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(4-bromo-3-methylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 171666329 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (NE,S)-N-[(4-bromo-3-methylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cc(/C=N/[S@@](=O)C(C)(C)C)ccc1Br |
| InChI | InChI=1S/C12H16BrNOS/c1-9-7-10(5-6-11(9)13)8-14-16(15)12(2,3)4/h5-8H,1-4H3/b14-8+/t16-/m0/s1 |
| InChIKey | AUXRFRBNZJDZQC-SBNBMVPLSA-N |
| XLogP | 3.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|