C13H18ClNOS — CID 58374474
(NE,S)-N-[(4-chloro-3,5-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 58374474) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is (NE,S)-N-[(4-chloro-3,5-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(4-chloro-3,5-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 58374474 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (NE,S)-N-[(4-chloro-3,5-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cc(/C=N/[S@@](=O)C(C)(C)C)cc(C)c1Cl |
| InChI | InChI=1S/C13H18ClNOS/c1-9-6-11(7-10(2)12(9)14)8-15-17(16)13(3,4)5/h6-8H,1-5H3/b15-8+/t17-/m0/s1 |
| InChIKey | RSSRUANFBRBZLG-BXUGYJKXSA-N |
| XLogP | 3.84 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|