C14H21NOS — CID 155662872
(NE,R)-2-methyl-N-[(4-propan-2-ylphenyl)methylidene]propane-2-sulfinamide (PubChem CID 155662872) has the molecular formula C14H21NOS and a molecular weight of 251.40 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[(4-propan-2-ylphenyl)methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[(4-propan-2-ylphenyl)methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 155662872 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (NE,R)-2-methyl-N-[(4-propan-2-ylphenyl)methylidene]propane-2-sulfinamide |
| SMILES | CC(C)c1ccc(/C=N/[S@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H21NOS/c1-11(2)13-8-6-12(7-9-13)10-15-17(16)14(3,4)5/h6-11H,1-5H3/b15-10+/t17-/m1/s1 |
| InChIKey | ICICZBZKUQJFFD-IUYQLWOBSA-N |
| XLogP | 3.69 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|