C11H14N2O3S — CID 11207533
(NE,R)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide (PubChem CID 11207533) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 11207533 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (NE,R)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14N2O3S/c1-11(2,3)17(16)12-8-9-4-6-10(7-5-9)13(14)15/h4-8H,1-3H3/b12-8+/t17-/m1/s1 |
| InChIKey | XNQNNFJWRGXIFE-FWVUHSSSSA-N |
| XLogP | 2.48 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|