C12H13F3N2O3S — CID 163731077
2-methyl-N-[[3-nitro-5-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide (PubChem CID 163731077) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-methyl-N-[[3-nitro-5-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[[3-nitro-5-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 163731077 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-methyl-N-[[3-nitro-5-(trifluoromethyl)phenyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3S/c1-11(2,3)21(20)16-7-8-4-9(12(13,14)15)6-10(5-8)17(18)19/h4-7H,1-3H3 |
| InChIKey | KZPALONJJRRDKO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|