C12H13BrF3NOS — CID 167530770
(R)-N-[[2-bromo-5-(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 167530770) has the molecular formula C12H13BrF3NOS and a molecular weight of 356.21 g/mol. Its IUPAC name is (R)-N-[[2-bromo-5-(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[[2-bromo-5-(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 167530770 |
| Molecular Formula | C12H13BrF3NOS |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | (R)-N-[[2-bromo-5-(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1cc(C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H13BrF3NOS/c1-11(2,3)19(18)17-7-8-6-9(12(14,15)16)4-5-10(8)13/h4-7H,1-3H3/t19-/m1/s1 |
| InChIKey | HAKQOFBONJAOQB-LJQANCHMSA-N |
| XLogP | 4.35 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|