C13H13F6NOS — CID 86615519
N-[[2,4-bis(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 86615519) has the molecular formula C13H13F6NOS and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[[2,4-bis(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[[2,4-bis(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 86615519 |
| Molecular Formula | C13H13F6NOS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[[2,4-bis(trifluoromethyl)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F6NOS/c1-11(2,3)22(21)20-7-8-4-5-9(12(14,15)16)6-10(8)13(17,18)19/h4-7H,1-3H3 |
| InChIKey | FFLXYYANJFRFFF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|