C12H13F3N2O4S — CID 59315508
(NE,R)-2-methyl-N-[[5-nitro-2-(trifluoromethoxy)phenyl]methylidene]propane-2-sulfinamide (PubChem CID 59315508) has the molecular formula C12H13F3N2O4S and a molecular weight of 338.31 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[[5-nitro-2-(trifluoromethoxy)phenyl]methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[[5-nitro-2-(trifluoromethoxy)phenyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 59315508 |
| Molecular Formula | C12H13F3N2O4S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | (NE,R)-2-methyl-N-[[5-nitro-2-(trifluoromethoxy)phenyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1cc([N+](=O)[O-])ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O4S/c1-11(2,3)22(20)16-7-8-6-9(17(18)19)4-5-10(8)21-12(13,14)15/h4-7H,1-3H3/b16-7+/t22-/m1/s1 |
| InChIKey | JSLLPFUQIOAJBN-QESPPMFYSA-N |
| XLogP | 3.37 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|