C12H13F4NO2S — CID 167713078
(S)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 167713078) has the molecular formula C12H13F4NO2S and a molecular weight of 311.30 g/mol. Its IUPAC name is (S)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 167713078 |
| Molecular Formula | C12H13F4NO2S |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (S)-N-[[2-fluoro-3-(trifluoromethoxy)phenyl]methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N=Cc1cccc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C12H13F4NO2S/c1-11(2,3)20(18)17-7-8-5-4-6-9(10(8)13)19-12(14,15)16/h4-7H,1-3H3/t20-/m0/s1 |
| InChIKey | FZAJSHJBXYJQNF-FQEVSTJZSA-N |
| XLogP | 3.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|