C11H13F2NOS — CID 123786002
N-[(2,6-difluorophenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 123786002) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2,6-difluorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 123786002 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[(2,6-difluorophenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2NOS/c1-11(2,3)16(15)14-7-8-9(12)5-4-6-10(8)13/h4-7H,1-3H3 |
| InChIKey | PKLOOHYWEVIZIK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|