C12H16ClNO2S — CID 150204962
(S)-N-[(5-chloro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 150204962) has the molecular formula C12H16ClNO2S and a molecular weight of 273.79 g/mol. Its IUPAC name is (S)-N-[(5-chloro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(5-chloro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 150204962 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (S)-N-[(5-chloro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc(Cl)cc1C=N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H16ClNO2S/c1-12(2,3)17(15)14-8-9-7-10(13)5-6-11(9)16-4/h5-8H,1-4H3/t17-/m0/s1 |
| InChIKey | FQHDAWKCZUVUQL-KRWDZBQOSA-N |
| XLogP | 3.23 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|