About (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide
(R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118953601) has the molecular formula C14H14Cl2N2OS
and a molecular weight of 329.25 g/mol. Its IUPAC name is (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 118953601 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N=Cc1cc2cc(Cl)ccc2nc1Cl |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-14(2,3)20(19)17-8-10-6-9-7-11(15)4-5-12(9)18-13(10)16/h4-8H,1-3H3/t20-/m1/s1 |
| InChIKey | JLEFKXNYVOTIJZ-HXUWFJFHSA-N |
| XLogP | 4.42 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide (CID 118953601) is (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide is CC(C)(C)[S@@](=O)N=Cc1cc2cc(Cl)ccc2nc1Cl.
What is the InChIKey of (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is JLEFKXNYVOTIJZ-HXUWFJFHSA-N. The full InChI is InChI=1S/C14H14Cl2N2OS/c1-14(2,3)20(19)17-8-10-6-9-7-11(15)4-5-12(9)18-13(10)16/h4-8H,1-3H3/t20-/m1/s1.
What are the key properties of (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide?
(R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 329.25 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[(2,6-dichloroquinolin-3-yl)methylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 118953601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).