C12H15F2NO2S — CID 150591949
(S)-N-[(4,5-difluoro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 150591949) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is (S)-N-[(4,5-difluoro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(4,5-difluoro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 150591949 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (S)-N-[(4,5-difluoro-2-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc(F)c(F)cc1C=N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H15F2NO2S/c1-12(2,3)18(16)15-7-8-5-9(13)10(14)6-11(8)17-4/h5-7H,1-4H3/t18-/m0/s1 |
| InChIKey | IQBFXZGTBMBGSZ-SFHVURJKSA-N |
| XLogP | 2.85 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|