C11H15NO2S — CID 136614195
N-[(4-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 136614195) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(4-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 136614195 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-[(4-hydroxyphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-11(2,3)15(14)12-8-9-4-6-10(13)7-5-9/h4-8,13H,1-3H3 |
| InChIKey | PXCYFLQRYLNJAT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|