C15H17N3O2S — CID 89479374
(NE,R)-2-methyl-N-[(4-pyrimidin-5-yloxyphenyl)methylidene]propane-2-sulfinamide (PubChem CID 89479374) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-[(4-pyrimidin-5-yloxyphenyl)methylidene]propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-[(4-pyrimidin-5-yloxyphenyl)methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 89479374 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (NE,R)-2-methyl-N-[(4-pyrimidin-5-yloxyphenyl)methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1ccc(Oc2cncnc2)cc1 |
| InChI | InChI=1S/C15H17N3O2S/c1-15(2,3)21(19)18-8-12-4-6-13(7-5-12)20-14-9-16-11-17-10-14/h4-11H,1-3H3/b18-8+/t21-/m1/s1 |
| InChIKey | XFHTWOCOWZUAOD-DPJUBJNGSA-N |
| XLogP | 3.15 |
| TPSA | 64.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|