C13H15Cl2NO3 — CID 23519151
tert-butyl 2-[(E)-(3,4-dichlorophenyl)methylideneamino]oxyacetate (PubChem CID 23519151) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is tert-butyl 2-[(E)-(3,4-dichlorophenyl)methylideneamino]oxyacetate.
| Compound Name | tert-butyl 2-[(E)-(3,4-dichlorophenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 23519151 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | tert-butyl 2-[(E)-(3,4-dichlorophenyl)methylideneamino]oxyacetate |
| SMILES | CC(C)(C)OC(=O)CO/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-13(2,3)19-12(17)8-18-16-7-9-4-5-10(14)11(15)6-9/h4-7H,8H2,1-3H3/b16-7+ |
| InChIKey | OIUTXXWRKMIGMF-FRKPEAEDSA-N |
| XLogP | 3.69 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|