C19H23N3O5S — CID 5044067
tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanylphenyl]methylideneamino]oxyacetate (PubChem CID 5044067) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanylphenyl]methylideneamino]oxyacetate.
| Compound Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanylphenyl]methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 5044067 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)sulfanylphenyl]methylideneamino]oxyacetate |
| SMILES | COc1cc(OC)nc(Sc2ccccc2C=NOCC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C19H23N3O5S/c1-19(2,3)27-17(23)12-26-20-11-13-8-6-7-9-14(13)28-18-21-15(24-4)10-16(22-18)25-5/h6-11H,12H2,1-5H3 |
| InChIKey | IHTZJHCDEAZYNE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|