C19H17N3O6 — CID 134122267
2-[(E)-[2-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]methylideneamino]oxyacetic acid (PubChem CID 134122267) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is 2-[(E)-[2-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[2-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 134122267 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[(E)-[2-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]methylideneamino]oxyacetic acid |
| SMILES | COc1cc(OC)nc(Oc2ccc3ccccc3c2/C=N/OCC(=O)O)n1 |
| InChI | InChI=1S/C19H17N3O6/c1-25-16-9-17(26-2)22-19(21-16)28-15-8-7-12-5-3-4-6-13(12)14(15)10-20-27-11-18(23)24/h3-10H,11H2,1-2H3,(H,23,24)/b20-10+ |
| InChIKey | TUBPSRWIJKHGQG-KEBDBYFISA-N |
| XLogP | 2.87 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|