C23H20N2O4 — CID 36565245
(Z)-1-(2-methoxynaphthalen-1-yl)-N-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine (PubChem CID 36565245) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (Z)-1-(2-methoxynaphthalen-1-yl)-N-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(2-methoxynaphthalen-1-yl)-N-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 36565245 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (Z)-1-(2-methoxynaphthalen-1-yl)-N-[[3-(4-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine |
| SMILES | COc1ccc(-c2cc(CO/N=C\c3c(OC)ccc4ccccc34)on2)cc1 |
| InChI | InChI=1S/C23H20N2O4/c1-26-18-10-7-17(8-11-18)22-13-19(29-25-22)15-28-24-14-21-20-6-4-3-5-16(20)9-12-23(21)27-2/h3-14H,15H2,1-2H3/b24-14- |
| InChIKey | LKCKRSDODAIQCL-OYKKKHCWSA-N |
| XLogP | 5.06 |
| TPSA | 66.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|