C20H20N2O4 — CID 43055474
(E)-1-(4-ethoxyphenyl)-N-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine (PubChem CID 43055474) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-1-(4-ethoxyphenyl)-N-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine.
| Compound Name | (E)-1-(4-ethoxyphenyl)-N-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 43055474 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-1-(4-ethoxyphenyl)-N-[[3-(2-methoxyphenyl)-1,2-oxazol-5-yl]methoxy]methanimine |
| SMILES | CCOc1ccc(/C=N/OCc2cc(-c3ccccc3OC)no2)cc1 |
| InChI | InChI=1S/C20H20N2O4/c1-3-24-16-10-8-15(9-11-16)13-21-25-14-17-12-19(22-26-17)18-6-4-5-7-20(18)23-2/h4-13H,3,14H2,1-2H3/b21-13+ |
| InChIKey | HGQDTDXHOCHANC-FYJGNVAPSA-N |
| XLogP | 4.30 |
| TPSA | 66.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|