C20H20ClN3O4 — CID 9355027
(Z)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-(3-methoxy-4-propoxyphenyl)methanimine (PubChem CID 9355027) has the molecular formula C20H20ClN3O4 and a molecular weight of 401.85 g/mol. Its IUPAC name is (Z)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-(3-methoxy-4-propoxyphenyl)methanimine.
| Compound Name | (Z)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-(3-methoxy-4-propoxyphenyl)methanimine |
|---|---|
| PubChem CID | 9355027 |
| Molecular Formula | C20H20ClN3O4 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (Z)-N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-1-(3-methoxy-4-propoxyphenyl)methanimine |
| SMILES | CCCOc1ccc(/C=N\OCc2nc(-c3ccccc3Cl)no2)cc1OC |
| InChI | InChI=1S/C20H20ClN3O4/c1-3-10-26-17-9-8-14(11-18(17)25-2)12-22-27-13-19-23-20(24-28-19)15-6-4-5-7-16(15)21/h4-9,11-12H,3,10,13H2,1-2H3/b22-12- |
| InChIKey | DHSFUXJQTVJUQF-UUYOSTAYSA-N |
| XLogP | 4.74 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|