C17H17ClFNO3 — CID 4850797
N-[(2-chloro-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine (PubChem CID 4850797) has the molecular formula C17H17ClFNO3 and a molecular weight of 337.78 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4850797 |
| Molecular Formula | C17H17ClFNO3 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine |
| SMILES | CCOc1ccc(C=NOCc2ccc(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C17H17ClFNO3/c1-3-22-16-7-4-12(8-17(16)21-2)10-20-23-11-13-5-6-14(19)9-15(13)18/h4-10H,3,11H2,1-2H3 |
| InChIKey | PUKYWZZSFGKBGB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|