C17H17BrFNO3 — CID 60523490
(E)-N-[(3-bromo-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine (PubChem CID 60523490) has the molecular formula C17H17BrFNO3 and a molecular weight of 382.23 g/mol. Its IUPAC name is (E)-N-[(3-bromo-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine.
| Compound Name | (E)-N-[(3-bromo-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 60523490 |
| Molecular Formula | C17H17BrFNO3 |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | (E)-N-[(3-bromo-4-fluorophenyl)methoxy]-1-(4-ethoxy-3-methoxyphenyl)methanimine |
| SMILES | CCOc1ccc(/C=N/OCc2ccc(F)c(Br)c2)cc1OC |
| InChI | InChI=1S/C17H17BrFNO3/c1-3-22-16-7-5-12(9-17(16)21-2)10-20-23-11-13-4-6-15(19)14(18)8-13/h4-10H,3,11H2,1-2H3/b20-10+ |
| InChIKey | WLXINZDRJMIZPF-KEBDBYFISA-N |
| XLogP | 4.55 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|