C22H29N3O6 — CID 3375552
tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylideneamino]oxy-3-methylbutanoate (PubChem CID 3375552) has the molecular formula C22H29N3O6 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylideneamino]oxy-3-methylbutanoate.
| Compound Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylideneamino]oxy-3-methylbutanoate |
|---|---|
| PubChem CID | 3375552 |
| Molecular Formula | C22H29N3O6 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | tert-butyl 2-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylideneamino]oxy-3-methylbutanoate |
| SMILES | COc1cc(OC)nc(Oc2ccccc2C=NOC(C(=O)OC(C)(C)C)C(C)C)n1 |
| InChI | InChI=1S/C22H29N3O6/c1-14(2)19(20(26)30-22(3,4)5)31-23-13-15-10-8-9-11-16(15)29-21-24-17(27-6)12-18(25-21)28-7/h8-14,19H,1-7H3 |
| InChIKey | VMJKHILBSJIKAO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 101.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|