C20H17Cl2N3O4 — CID 88512625
(Z)-N-[(2,4-dichlorophenyl)methoxy]-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine (PubChem CID 88512625) has the molecular formula C20H17Cl2N3O4 and a molecular weight of 434.28 g/mol. Its IUPAC name is (Z)-N-[(2,4-dichlorophenyl)methoxy]-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine.
| Compound Name | (Z)-N-[(2,4-dichlorophenyl)methoxy]-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine |
|---|---|
| PubChem CID | 88512625 |
| Molecular Formula | C20H17Cl2N3O4 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | (Z)-N-[(2,4-dichlorophenyl)methoxy]-1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methanimine |
| SMILES | COc1cc(OC)nc(Oc2ccccc2/C=N\OCc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H17Cl2N3O4/c1-26-18-10-19(27-2)25-20(24-18)29-17-6-4-3-5-13(17)11-23-28-12-14-7-8-15(21)9-16(14)22/h3-11H,12H2,1-2H3/b23-11- |
| InChIKey | MUVHYJNOCCDNCD-KSEXSDGBSA-N |
| XLogP | 5.14 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|