C24H31N3O4 — CID 143730152
1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-N-(3-methoxyphenyl)methanimine;ethane (PubChem CID 143730152) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-N-(3-methoxyphenyl)methanimine;ethane.
| Compound Name | 1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-N-(3-methoxyphenyl)methanimine;ethane |
|---|---|
| PubChem CID | 143730152 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 1-[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]-N-(3-methoxyphenyl)methanimine;ethane |
| SMILES | CC.CC.COc1cccc(/N=C/c2ccccc2Oc2nc(OC)cc(OC)n2)c1 |
| InChI | InChI=1S/C20H19N3O4.2C2H6/c1-24-16-9-6-8-15(11-16)21-13-14-7-4-5-10-17(14)27-20-22-18(25-2)12-19(23-20)26-3;2*1-2/h4-13H,1-3H3;2*1-2H3/b21-13+;; |
| InChIKey | RAZOOVAQGKTSLG-ORKRDPRMSA-N |
| XLogP | 6.10 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|