C14H14N2O5 — CID 139643232
2-(4,6-dimethoxypyrimidin-2-yl)oxy-4-methoxybenzaldehyde (PubChem CID 139643232) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)oxy-4-methoxybenzaldehyde.
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 139643232 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)oxy-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)c(Oc2nc(OC)cc(OC)n2)c1 |
| InChI | InChI=1S/C14H14N2O5/c1-18-10-5-4-9(8-17)11(6-10)21-14-15-12(19-2)7-13(16-14)20-3/h4-8H,1-3H3 |
| InChIKey | QORNBQJDZPJWMU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|