C13H12N2O5 — CID 4615865
4-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid (PubChem CID 4615865) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid.
| Compound Name | 4-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid |
|---|---|
| PubChem CID | 4615865 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(4,6-dimethoxypyrimidin-2-yl)oxybenzoic acid |
| SMILES | COc1cc(OC)nc(Oc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C13H12N2O5/c1-18-10-7-11(19-2)15-13(14-10)20-9-5-3-8(4-6-9)12(16)17/h3-7H,1-2H3,(H,16,17) |
| InChIKey | HPJQTEWUHMYVKW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |