C14H14N2O5 — CID 134120094
[3-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl] acetate (PubChem CID 134120094) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is [3-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl] acetate.
| Compound Name | [3-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl] acetate |
|---|---|
| PubChem CID | 134120094 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [3-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl] acetate |
| SMILES | COc1cc(OC)nc(Oc2cccc(OC(C)=O)c2)n1 |
| InChI | InChI=1S/C14H14N2O5/c1-9(17)20-10-5-4-6-11(7-10)21-14-15-12(18-2)8-13(16-14)19-3/h4-8H,1-3H3 |
| InChIKey | WPPQZEZUAFHXIU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|