C19H16N2O6 — CID 54269329
methyl 2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-2-oxoacetate (PubChem CID 54269329) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is methyl 2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-2-oxoacetate.
| Compound Name | methyl 2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 54269329 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | methyl 2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1cccc2ccc(Oc3nc(OC)cc(OC)n3)cc12 |
| InChI | InChI=1S/C19H16N2O6/c1-24-15-10-16(25-2)21-19(20-15)27-12-8-7-11-5-4-6-13(14(11)9-12)17(22)18(23)26-3/h4-10H,1-3H3 |
| InChIKey | RJALLTQROCRBOC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|