C20H18N2O6 — CID 67643765
(E)-2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-3-methoxyprop-2-enoic acid (PubChem CID 67643765) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is (E)-2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67643765 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (E)-2-[7-(4,6-dimethoxypyrimidin-2-yl)oxynaphthalen-1-yl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1cccc2ccc(Oc3nc(OC)cc(OC)n3)cc12 |
| InChI | InChI=1S/C20H18N2O6/c1-25-11-16(19(23)24)14-6-4-5-12-7-8-13(9-15(12)14)28-20-21-17(26-2)10-18(22-20)27-3/h4-11H,1-3H3,(H,23,24)/b16-11+ |
| InChIKey | MCFJBRXHHLUYQU-LFIBNONCSA-N |
| XLogP | 3.51 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|