C23H20O5 — CID 22243719
(Z)-2-[2-[3-[hydroxy(phenyl)methyl]phenoxy]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 22243719) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is (Z)-2-[2-[3-[hydroxy(phenyl)methyl]phenoxy]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (Z)-2-[2-[3-[hydroxy(phenyl)methyl]phenoxy]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 22243719 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (Z)-2-[2-[3-[hydroxy(phenyl)methyl]phenoxy]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(\C(=O)O)c1ccccc1Oc1cccc(C(O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H20O5/c1-27-15-20(23(25)26)19-12-5-6-13-21(19)28-18-11-7-10-17(14-18)22(24)16-8-3-2-4-9-16/h2-15,22,24H,1H3,(H,25,26)/b20-15- |
| InChIKey | RULFIJYPMFXJDW-HKWRFOASSA-N |
| XLogP | 4.63 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|