C11H10O6 — CID 173202004
3-[(Z)-1-carboxy-2-methoxyethenyl]-2-hydroxybenzoic acid (PubChem CID 173202004) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is 3-[(Z)-1-carboxy-2-methoxyethenyl]-2-hydroxybenzoic acid.
| Compound Name | 3-[(Z)-1-carboxy-2-methoxyethenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 173202004 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-[(Z)-1-carboxy-2-methoxyethenyl]-2-hydroxybenzoic acid |
| SMILES | CO/C=C(\C(=O)O)c1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C11H10O6/c1-17-5-8(11(15)16)6-3-2-4-7(9(6)12)10(13)14/h2-5,12H,1H3,(H,13,14)(H,15,16)/b8-5- |
| InChIKey | JEDZQRUNEYQXKF-YVMONPNESA-N |
| XLogP | 1.16 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|