C11H11BrO3 — CID 22849200
(E)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 22849200) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is (E)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 22849200 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | (E)-2-[2-(bromomethyl)phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1CBr |
| InChI | InChI=1S/C11H11BrO3/c1-15-7-10(11(13)14)9-5-3-2-4-8(9)6-12/h2-5,7H,6H2,1H3,(H,13,14)/b10-7+ |
| InChIKey | IEKVQKPPDFYRLD-JXMROGBWSA-N |
| XLogP | 2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|