C17H14Br2O3S — CID 67827593
(E)-2-[2-[(2,5-dibromophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 67827593) has the molecular formula C17H14Br2O3S and a molecular weight of 458.17 g/mol. Its IUPAC name is (E)-2-[2-[(2,5-dibromophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(2,5-dibromophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67827593 |
| Molecular Formula | C17H14Br2O3S |
| Molecular Weight | 458.17 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | (E)-2-[2-[(2,5-dibromophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1SCc1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H14Br2O3S/c1-22-9-14(17(20)21)13-4-2-3-5-16(13)23-10-11-8-12(18)6-7-15(11)19/h2-9H,10H2,1H3,(H,20,21)/b14-9+ |
| InChIKey | WXSMOBLYWQNIFZ-NTEUORMPSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.17 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|