C17H15ClO3S — CID 18650173
(E)-2-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 18650173) has the molecular formula C17H15ClO3S and a molecular weight of 334.82 g/mol. Its IUPAC name is (E)-2-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | (E)-2-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 18650173 |
| Molecular Formula | C17H15ClO3S |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (E)-2-[2-[(4-chlorophenyl)methylsulfanyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CO/C=C(/C(=O)O)c1ccccc1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClO3S/c1-21-10-15(17(19)20)14-4-2-3-5-16(14)22-11-12-6-8-13(18)9-7-12/h2-10H,11H2,1H3,(H,19,20)/b15-10+ |
| InChIKey | WROKJUMFJGFUIH-XNTDXEJSSA-N |
| XLogP | 4.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|