C13H14O4S — CID 173376695
2-[2-(acetylsulfanylmethyl)phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 173376695) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[2-(acetylsulfanylmethyl)phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-(acetylsulfanylmethyl)phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 173376695 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[2-(acetylsulfanylmethyl)phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | COC=C(C(=O)O)c1ccccc1CSC(C)=O |
| InChI | InChI=1S/C13H14O4S/c1-9(14)18-8-10-5-3-4-6-11(10)12(7-17-2)13(15)16/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | LBCZAGSREHFQNU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|