C18H15NO8 — CID 70156329
3-methoxy-2-[2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]prop-2-enoic acid (PubChem CID 70156329) has the molecular formula C18H15NO8 and a molecular weight of 373.32 g/mol. Its IUPAC name is 3-methoxy-2-[2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-methoxy-2-[2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70156329 |
| Molecular Formula | C18H15NO8 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-methoxy-2-[2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]prop-2-enoic acid |
| SMILES | COC=C(C(=O)O)c1ccccc1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15NO8/c1-25-11-16(17(20)21)15-5-3-2-4-12(15)10-26-18(22)27-14-8-6-13(7-9-14)19(23)24/h2-9,11H,10H2,1H3,(H,20,21) |
| InChIKey | QCAWDGSLIYNBEM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|