About [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate
[2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 70101379) has the molecular formula C15H9F4NO5
and a molecular weight of 359.23 g/mol. Its IUPAC name is [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate |
| PubChem CID | 70101379 |
| Molecular Formula | C15H9F4NO5 |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | O=C(OCc1cccc(C(F)(F)F)c1F)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H9F4NO5/c16-13-9(2-1-3-12(13)15(17,18)19)8-24-14(21)25-11-6-4-10(5-7-11)20(22)23/h1-7H,8H2 |
| InChIKey | FRBBTEWEZOKWAD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate?
The IUPAC name of [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate (CID 70101379) is [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate.
What is the SMILES notation for [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate?
The canonical SMILES for [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate is O=C(OCc1cccc(C(F)(F)F)c1F)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate?
The InChIKey is FRBBTEWEZOKWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F4NO5/c16-13-9(2-1-3-12(13)15(17,18)19)8-24-14(21)25-11-6-4-10(5-7-11)20(22)23/h1-7H,8H2.
What are the key properties of [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate?
[2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate has a molecular weight of 359.23 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-3-(trifluoromethyl)phenyl]methyl (4-nitrophenyl) carbonate is sourced from PubChem (CID 70101379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).