C15H12N2O7 — CID 138585746
[3-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]carbamic acid (PubChem CID 138585746) has the molecular formula C15H12N2O7 and a molecular weight of 332.27 g/mol. Its IUPAC name is [3-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]carbamic acid.
| Compound Name | [3-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 138585746 |
| Molecular Formula | C15H12N2O7 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [3-[(4-nitrophenoxy)carbonyloxymethyl]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1cccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H12N2O7/c18-14(19)16-11-3-1-2-10(8-11)9-23-15(20)24-13-6-4-12(5-7-13)17(21)22/h1-8,16H,9H2,(H,18,19) |
| InChIKey | JLXUHIAZSFEYIG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|