C17H16N3O7- — CID 155721359
2-(3-aminopropanoylamino)-4-[(4-nitrophenoxy)carbonyloxymethyl]phenolate (PubChem CID 155721359) has the molecular formula C17H16N3O7- and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-(3-aminopropanoylamino)-4-[(4-nitrophenoxy)carbonyloxymethyl]phenolate.
| Compound Name | 2-(3-aminopropanoylamino)-4-[(4-nitrophenoxy)carbonyloxymethyl]phenolate |
|---|---|
| PubChem CID | 155721359 |
| Molecular Formula | C17H16N3O7- |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-(3-aminopropanoylamino)-4-[(4-nitrophenoxy)carbonyloxymethyl]phenolate |
| SMILES | NCCC(=O)Nc1cc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)ccc1[O-] |
| InChI | InChI=1S/C17H17N3O7/c18-8-7-16(22)19-14-9-11(1-6-15(14)21)10-26-17(23)27-13-4-2-12(3-5-13)20(24)25/h1-6,9,21H,7-8,10,18H2,(H,19,22)/p-1 |
| InChIKey | AJPDQJFILMWKBQ-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|