About (3-chlorophenyl)methyl (4-nitrophenyl) carbonate
(3-chlorophenyl)methyl (4-nitrophenyl) carbonate (PubChem CID 22075943) has the molecular formula C14H10ClNO5
and a molecular weight of 307.69 g/mol. Its IUPAC name is (3-chlorophenyl)methyl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl (4-nitrophenyl) carbonate |
| PubChem CID | 22075943 |
| Molecular Formula | C14H10ClNO5 |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (3-chlorophenyl)methyl (4-nitrophenyl) carbonate |
| SMILES | O=C(OCc1cccc(Cl)c1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10ClNO5/c15-11-3-1-2-10(8-11)9-20-14(17)21-13-6-4-12(5-7-13)16(18)19/h1-8H,9H2 |
| InChIKey | ABWDVWJYKMYQPC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)methyl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl (4-nitrophenyl) carbonate?
The IUPAC name of (3-chlorophenyl)methyl (4-nitrophenyl) carbonate (CID 22075943) is (3-chlorophenyl)methyl (4-nitrophenyl) carbonate.
What is the SMILES notation for (3-chlorophenyl)methyl (4-nitrophenyl) carbonate?
The canonical SMILES for (3-chlorophenyl)methyl (4-nitrophenyl) carbonate is O=C(OCc1cccc(Cl)c1)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (3-chlorophenyl)methyl (4-nitrophenyl) carbonate?
The InChIKey is ABWDVWJYKMYQPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClNO5/c15-11-3-1-2-10(8-11)9-20-14(17)21-13-6-4-12(5-7-13)16(18)19/h1-8H,9H2.
What are the key properties of (3-chlorophenyl)methyl (4-nitrophenyl) carbonate?
(3-chlorophenyl)methyl (4-nitrophenyl) carbonate has a molecular weight of 307.69 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl (4-nitrophenyl) carbonate is sourced from PubChem (CID 22075943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).